CAS 1821308-45-5 appears in our catalog under these names: 2,5,6-Trichloro-3-methyl-3,4-dihydropyrimidin-4-one, 95%, 2,5,6–Trichloro–3–methylpyrimidin–4(3H)–one, 2,5,6-trichloro-3-methyl-3,4-dihydropyrimidin-4-one, 97%, 97%, 2,5,6-Trichloro-3-methylpyrimidin-4(3H)-one, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g, 25g, 100g.
2,5,6-trichloro-3-methylpyrimidin-4-one (CAS 1821308-45-5) is a chemical compound with the molecular formula C5H3Cl3N2O and a molecular weight of 213.44 g/mol. IUPAC name: 2,5,6-trichloro-3-methylpyrimidin-4-one. InChIKey: QYISNYYGONBDTR-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl3N2O |
|---|---|
| Molecular weight | 213.44 g/mol |
| IUPAC name | 2,5,6-trichloro-3-methylpyrimidin-4-one |
| InChIKey | QYISNYYGONBDTR-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(N=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)