CAS 1821309-39-0 appears in our catalog under these names: HIV-1 inhibitor-6 / 98.49% (existing batch purity), HIV–1 inhibitor–6, HIV-1 inhibitor-6, HIV-1 inhibitor-6, 99.10%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 50 mg.
1-methyl-N-(5-nitro-1,2-benzothiazol-3-yl)-4-oxopyridine-3-carboxamide (CAS 1821309-39-0) is a chemical compound with the molecular formula C14H10N4O4S and a molecular weight of 330.32 g/mol. IUPAC name: 1-methyl-N-(5-nitro-1,2-benzothiazol-3-yl)-4-oxopyridine-3-carboxamide. InChIKey: CPKUAABJFWRBSN-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O4S |
|---|---|
| Molecular weight | 330.32 g/mol |
| IUPAC name | 1-methyl-N-(5-nitro-1,2-benzothiazol-3-yl)-4-oxopyridine-3-carboxamide |
| InChIKey | CPKUAABJFWRBSN-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=O)C(=C1)C(=O)NC2=NSC3=C2C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)