CAS 1821379-62-7 is the registry number for (R)-Pirlindole (mesylate). Offered by: MedChemExpress. Available pack sizes: Get quote.
Methanesulfonic acid;(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene (CAS 1821379-62-7) is a chemical compound with the molecular formula C16H22N2O3S and a molecular weight of 322.4 g/mol. IUPAC name: methanesulfonic acid;(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene. InChIKey: PVUYTBQAVAYLDE-BTQNPOSSSA-N.
| Molecular formula | C16H22N2O3S |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | methanesulfonic acid;(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
| InChIKey | PVUYTBQAVAYLDE-BTQNPOSSSA-N |
| SMILES | CC1=CC2=C(C=C1)N3CCN[C@H]4C3=C2CCC4.CS(=O)(=O)O |
Computed by PubChem (NCBI)