CAS 1821387-73-8 appears in our catalog under these names: CU-T12-9, CU-T12-9/ 99.93% (existing batch purity), CU–T12–9, CU-T12-9 98%, CU-T12-9, ≥98%, ≥98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
N-methyl-4-nitro-2-[4-[4-(trifluoromethyl)phenyl]imidazol-1-yl]aniline (CAS 1821387-73-8) is a chemical compound with the molecular formula C17H13F3N4O2 and a molecular weight of 362.31 g/mol. IUPAC name: N-methyl-4-nitro-2-[4-[4-(trifluoromethyl)phenyl]imidazol-1-yl]aniline. InChIKey: LITXVDAFEYLWQE-UHFFFAOYSA-N.
| Molecular formula | C17H13F3N4O2 |
|---|---|
| Molecular weight | 362.31 g/mol |
| IUPAC name | N-methyl-4-nitro-2-[4-[4-(trifluoromethyl)phenyl]imidazol-1-yl]aniline |
| InChIKey | LITXVDAFEYLWQE-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)[N+](=O)[O-])N2C=C(N=C2)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)