CAS 1821401-91-5 is the registry number for rac-tert-Butyl (1S,3R,5R)-8-azaspiro(bicyclo(3.2.1)octane-3,2'-oxirane)-8-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (1R,5S)-spiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane]-8-carboxylate (CAS 1821401-91-5) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl (1R,5S)-spiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane]-8-carboxylate. InChIKey: CPDRWKNXZSZLBV-HWYHXSKPSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl (1R,5S)-spiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane]-8-carboxylate |
| InChIKey | CPDRWKNXZSZLBV-HWYHXSKPSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC3(C2)CO3 |
Computed by PubChem (NCBI)