CAS 1821498-25-2 appears in our catalog under these names: Amlodipine Impurity 18, Amlodipine Impurity 16, Amlodipine Impurity 14, 3-O-Desethyl-5-O-desmethyl amlodipine. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid (CAS 1821498-25-2) is a chemical compound with the molecular formula C17H19ClN2O5 and a molecular weight of 366.8 g/mol. IUPAC name: 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid. InChIKey: QQUGAJMOSWOMFG-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O5 |
|---|---|
| Molecular weight | 366.8 g/mol |
| IUPAC name | 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic acid |
| InChIKey | QQUGAJMOSWOMFG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)COCCN)C(=O)O)C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)