CAS 1821666-70-9 appears in our catalog under these names: Pazopanib Impurity 48, 2-Methyl-5-((4-(methylamino)pyrimidin-2-yl)amino)benzenesulfonamide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-methyl-5-[[4-(methylamino)pyrimidin-2-yl]amino]benzenesulfonamide (CAS 1821666-70-9) is a chemical compound with the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. IUPAC name: 2-methyl-5-[[4-(methylamino)pyrimidin-2-yl]amino]benzenesulfonamide. InChIKey: QQXZFTYKLCKHJO-UHFFFAOYSA-N.
| Molecular formula | C12H15N5O2S |
|---|---|
| Molecular weight | 293.35 g/mol |
| IUPAC name | 2-methyl-5-[[4-(methylamino)pyrimidin-2-yl]amino]benzenesulfonamide |
| InChIKey | QQXZFTYKLCKHJO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)NC)S(=O)(=O)N |
Computed by PubChem (NCBI)