CAS 1821718-75-5 is the registry number for (1S,3R)-3-Phenylcyclohexan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,3R)-3-phenylcyclohexan-1-amine (CAS 1821718-75-5) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: cis-(1S,3R)-3-phenylcyclohexan-1-amine. InChIKey: CJRUDCMOPMVAIB-NEPJUHHUSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | cis-(1S,3R)-3-phenylcyclohexan-1-amine |
| InChIKey | CJRUDCMOPMVAIB-NEPJUHHUSA-N |
| SMILES | C1C[C@H](C[C@H](C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)