CAS 1821720-58-4 is the registry number for (2S,5R)-1-Benzyl-5-ethyl-2-methylpiperazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,5R)-1-benzyl-5-ethyl-2-methylpiperazine (CAS 1821720-58-4) is a chemical compound with the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. IUPAC name: (2S,5R)-1-benzyl-5-ethyl-2-methylpiperazine. InChIKey: WMQIYLJQZHLVOF-GXTWGEPZSA-N.
| Molecular formula | C14H22N2 |
|---|---|
| Molecular weight | 218.34 g/mol |
| IUPAC name | (2S,5R)-1-benzyl-5-ethyl-2-methylpiperazine |
| InChIKey | WMQIYLJQZHLVOF-GXTWGEPZSA-N |
| SMILES | CC[C@@H]1CN([C@H](CN1)C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)