CAS 1821725-49-8 is the registry number for (2R,6S)-2-Methyl-6-(trifluoromethyl)morpholine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,6S)-2-methyl-6-(trifluoromethyl)morpholine (CAS 1821725-49-8) is a chemical compound with the molecular formula C6H10F3NO and a molecular weight of 169.14 g/mol. IUPAC name: (2R,6S)-2-methyl-6-(trifluoromethyl)morpholine. InChIKey: BPVZRPRBZRIGRK-UHNVWZDZSA-N.
| Molecular formula | C6H10F3NO |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | (2R,6S)-2-methyl-6-(trifluoromethyl)morpholine |
| InChIKey | BPVZRPRBZRIGRK-UHNVWZDZSA-N |
| SMILES | C[C@@H]1CNC[C@H](O1)C(F)(F)F |
Computed by PubChem (NCBI)