Products 1821738-74-2
CAS 1821738-74-2 is the registry number for rac-(1R,5S)-7,7-Dimethylbicyclo(3.2.0)heptan-6-one. Offered by: Biosynth. Available pack sizes: 0,05g, 0,5g.
(1R,5S)-7,7-dimethylbicyclo[3.2.0]heptan-6-one (CAS 1821738-74-2) is a chemical compound with the molecular formula C9H14O and a molecular weight of 138.21 g/mol. IUPAC name: (1R,5S)-7,7-dimethylbicyclo[3.2.0]heptan-6-one. InChIKey: INDMRFDFEBAXTK-NKWVEPMBSA-N.
| Molecular formula | C9H14O |
|---|---|
| Molecular weight | 138.21 g/mol |
| IUPAC name | (1R,5S)-7,7-dimethylbicyclo[3.2.0]heptan-6-one |
| InChIKey | INDMRFDFEBAXTK-NKWVEPMBSA-N |
| SMILES | CC1([C@@H]2CCC[C@@H]2C1=O)C |
Computed by PubChem (NCBI)