CAS 1821738-84-4 appears in our catalog under these names: (1S,3R)-3-Methoxy-cyclohexylamine hydrochloride, (1S,3R)-3-Methoxycyclohexan-1-amine hydrochloride 97%, (1S,3R)-3-Methoxycyclohexan-1-amine hydrochloride, 97%, 97%, (1S,3R)-3-Methoxy-cyclohexylamine hydrochloride, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg.
Cis-(1S,3R)-3-methoxycyclohexan-1-amine;hydrochloride (CAS 1821738-84-4) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: cis-(1S,3R)-3-methoxycyclohexan-1-amine;hydrochloride. InChIKey: VUHNATIEYBXEGU-UOERWJHTSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | cis-(1S,3R)-3-methoxycyclohexan-1-amine;hydrochloride |
| InChIKey | VUHNATIEYBXEGU-UOERWJHTSA-N |
| SMILES | CO[C@@H]1CCC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)