CAS 1821790-63-9 appears in our catalog under these names: (1S,5R)-1,3,3,5-Tetramethylcyclohexan-1-amine, 95%, (1S,5R)-1,3,3,5-Tetramethylcyclohexan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Trans-(1S,5R)-1,3,3,5-tetramethylcyclohexan-1-amine (CAS 1821790-63-9) is a chemical compound with the molecular formula C10H21N and a molecular weight of 155.28 g/mol. IUPAC name: trans-(1S,5R)-1,3,3,5-tetramethylcyclohexan-1-amine. InChIKey: WCYNWVWYGZJUFX-SCZZXKLOSA-N.
| Molecular formula | C10H21N |
|---|---|
| Molecular weight | 155.28 g/mol |
| IUPAC name | trans-(1S,5R)-1,3,3,5-tetramethylcyclohexan-1-amine |
| InChIKey | WCYNWVWYGZJUFX-SCZZXKLOSA-N |
| SMILES | C[C@H]1C[C@](CC(C1)(C)C)(C)N |
Computed by PubChem (NCBI)