CAS 1821803-65-9 is the registry number for (1R,5R,6R)-6-(Trifluoromethyl)-2-azabicyclo[3.1.0]hexane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5R,6R)-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane (CAS 1821803-65-9) is a chemical compound with the molecular formula C6H8F3N and a molecular weight of 151.13 g/mol. IUPAC name: (1R,5R,6R)-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane. InChIKey: KVCSRQUURKKCKG-UOWFLXDJSA-N.
| Molecular formula | C6H8F3N |
|---|---|
| Molecular weight | 151.13 g/mol |
| IUPAC name | (1R,5R,6R)-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane |
| InChIKey | KVCSRQUURKKCKG-UOWFLXDJSA-N |
| SMILES | C1CN[C@@H]2[C@H]1[C@H]2C(F)(F)F |
Computed by PubChem (NCBI)