CAS 1821805-31-5 is the registry number for Cis-1-methyloctahydro-1,6-naphthyridin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(4aS,8aR)-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one (CAS 1821805-31-5) is a chemical compound with the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. IUPAC name: (4aS,8aR)-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one. InChIKey: CXOXGMBPBCDYNB-JGVFFNPUSA-N.
| Molecular formula | C9H16N2O |
|---|---|
| Molecular weight | 168.24 g/mol |
| IUPAC name | (4aS,8aR)-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| InChIKey | CXOXGMBPBCDYNB-JGVFFNPUSA-N |
| SMILES | CN1[C@@H]2CCNC[C@@H]2CCC1=O |
Computed by PubChem (NCBI)