CAS 1821823-29-3 is the registry number for (S)-1-(2,2,2-Trifluoroethyl)piperidin-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-1-(2,2,2-trifluoroethyl)piperidin-3-amine (CAS 1821823-29-3) is a chemical compound with the molecular formula C7H13F3N2 and a molecular weight of 182.19 g/mol. IUPAC name: (3S)-1-(2,2,2-trifluoroethyl)piperidin-3-amine. InChIKey: LFNPPORHPVBDHE-LURJTMIESA-N.
| Molecular formula | C7H13F3N2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | (3S)-1-(2,2,2-trifluoroethyl)piperidin-3-amine |
| InChIKey | LFNPPORHPVBDHE-LURJTMIESA-N |
| SMILES | C1C[C@@H](CN(C1)CC(F)(F)F)N |
Computed by PubChem (NCBI)