CAS 1821824-32-1 is the registry number for (1R,3S)-Ethyl 3-hydroxycyclohexanecarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 10g.
Cis-ethyl (1R,3S)-3-hydroxycyclohexane-1-carboxylate (CAS 1821824-32-1) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: cis-ethyl (1R,3S)-3-hydroxycyclohexane-1-carboxylate. InChIKey: BGAOLPQGOBDXBH-SFYZADRCSA-N.
| Molecular formula | C9H16O3 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | cis-ethyl (1R,3S)-3-hydroxycyclohexane-1-carboxylate |
| InChIKey | BGAOLPQGOBDXBH-SFYZADRCSA-N |
| SMILES | CCOC(=O)[C@@H]1CCC[C@@H](C1)O |
Computed by PubChem (NCBI)