CAS 1821824-64-9 is the registry number for tert-Butyl (2R,5R)-2-(iodomethyl)-1,7-dioxa-10-azaspiro[4.6]undecane-10-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,5R)-2-(iodomethyl)-1,10-dioxa-7-azaspiro[4.6]undecane-7-carboxylate (CAS 1821824-64-9) is a chemical compound with the molecular formula C14H24INO4 and a molecular weight of 397.25 g/mol. IUPAC name: tert-butyl (2R,5R)-2-(iodomethyl)-1,10-dioxa-7-azaspiro[4.6]undecane-7-carboxylate. InChIKey: GXDDETCOIZTESK-BXUZGUMPSA-N.
| Molecular formula | C14H24INO4 |
|---|---|
| Molecular weight | 397.25 g/mol |
| IUPAC name | tert-butyl (2R,5R)-2-(iodomethyl)-1,10-dioxa-7-azaspiro[4.6]undecane-7-carboxylate |
| InChIKey | GXDDETCOIZTESK-BXUZGUMPSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@]2(C1)CC[C@@H](O2)CI |
Computed by PubChem (NCBI)