CAS 2177258-10-3 is the registry number for Racemic-(2r,5r)-tert-butyl 2-(iodomethyl)-1,7-dioxa-10-azaspiro[4.6]undecane-10-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (2R,5S)-2-(iodomethyl)-1,10-dioxa-7-azaspiro[4.6]undecane-7-carboxylate (CAS 2177258-10-3) is a chemical compound with the molecular formula C14H24INO4 and a molecular weight of 397.25 g/mol. IUPAC name: tert-butyl (2R,5S)-2-(iodomethyl)-1,10-dioxa-7-azaspiro[4.6]undecane-7-carboxylate. InChIKey: GXDDETCOIZTESK-RISCZKNCSA-N.
| Molecular formula | C14H24INO4 |
|---|---|
| Molecular weight | 397.25 g/mol |
| IUPAC name | tert-butyl (2R,5S)-2-(iodomethyl)-1,10-dioxa-7-azaspiro[4.6]undecane-7-carboxylate |
| InChIKey | GXDDETCOIZTESK-RISCZKNCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@@]2(C1)CC[C@@H](O2)CI |
Computed by PubChem (NCBI)