CAS 1821837-31-3 appears in our catalog under these names: (R)-4,5-dimethyl-2-(pyrrolidin-2-yl)thiazole hydrobromide, 95%, (R)-4,5-Dimethyl-2-(pyrrolidin-2-yl)thiazole, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100mg, on request.
4,5-dimethyl-2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole (CAS 1821837-31-3) is a chemical compound with the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. IUPAC name: 4,5-dimethyl-2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole. InChIKey: CZVUSQZWKHWOLS-MRVPVSSYSA-N.
| Molecular formula | C9H14N2S |
|---|---|
| Molecular weight | 182.29 g/mol |
| IUPAC name | 4,5-dimethyl-2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole |
| InChIKey | CZVUSQZWKHWOLS-MRVPVSSYSA-N |
| SMILES | CC1=C(SC(=N1)[C@H]2CCCN2)C |
Computed by PubChem (NCBI)