Products 18221-58-4
CAS 18221-58-4 is the registry number for (R)-2-(o-Tolyloxy)propanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(2-methylphenoxy)propanoic acid (CAS 18221-58-4) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: (2R)-2-(2-methylphenoxy)propanoic acid. InChIKey: YIGXGYDKDDWZLS-MRVPVSSYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (2R)-2-(2-methylphenoxy)propanoic acid |
| InChIKey | YIGXGYDKDDWZLS-MRVPVSSYSA-N |
| SMILES | CC1=CC=CC=C1O[C@H](C)C(=O)O |
Computed by PubChem (NCBI)