CAS 182210-71-5 is the registry number for Posaconazole Impurity 115. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R,5R)-5-(2,4-difluorophenyl)-5-(iodomethyl)oxolan-3-yl]methanol (CAS 182210-71-5) is a chemical compound with the molecular formula C12H13F2IO2 and a molecular weight of 354.13 g/mol. IUPAC name: [(3R,5R)-5-(2,4-difluorophenyl)-5-(iodomethyl)oxolan-3-yl]methanol. InChIKey: LBIQKAGCCORVET-PELKAZGASA-N.
| Molecular formula | C12H13F2IO2 |
|---|---|
| Molecular weight | 354.13 g/mol |
| IUPAC name | [(3R,5R)-5-(2,4-difluorophenyl)-5-(iodomethyl)oxolan-3-yl]methanol |
| InChIKey | LBIQKAGCCORVET-PELKAZGASA-N |
| SMILES | C1[C@@H](CO[C@@]1(CI)C2=C(C=C(C=C2)F)F)CO |
Computed by PubChem (NCBI)