CAS 1822308-02-0 is the registry number for (S)-3-Amino-4,4,4-trifluorobutan-1-ol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-amino-4,4,4-trifluorobutan-1-ol;hydrochloride (CAS 1822308-02-0) is a chemical compound with the molecular formula C4H9ClF3NO and a molecular weight of 179.57 g/mol. IUPAC name: (3S)-3-amino-4,4,4-trifluorobutan-1-ol;hydrochloride. InChIKey: NRAPSDJOBAOKER-DFWYDOINSA-N.
| Molecular formula | C4H9ClF3NO |
|---|---|
| Molecular weight | 179.57 g/mol |
| IUPAC name | (3S)-3-amino-4,4,4-trifluorobutan-1-ol;hydrochloride |
| InChIKey | NRAPSDJOBAOKER-DFWYDOINSA-N |
| SMILES | C(CO)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)