CAS 1822374-49-1 is the registry number for 2-([1,2'-Binaphthalen]-6'-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,4,5,5-tetramethyl-2-(6-naphthalen-1-ylnaphthalen-2-yl)-1,3,2-dioxaborolane (CAS 1822374-49-1) is a chemical compound with the molecular formula C26H25BO2 and a molecular weight of 380.3 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(6-naphthalen-1-ylnaphthalen-2-yl)-1,3,2-dioxaborolane. InChIKey: DMGOQGYEHGTQEC-UHFFFAOYSA-N.
| Molecular formula | C26H25BO2 |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(6-naphthalen-1-ylnaphthalen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | DMGOQGYEHGTQEC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=C(C=C3)C4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)