CAS 1822551-68-7 is the registry number for 1-[(TERT-BUTOXY)CARBONYL]-3,3-DIMETHYL-1,3-AZASILOLIDINE-5-CARBOXYLIC ACID, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-azasilolidine-5-carboxylic acid (CAS 1822551-68-7) is a chemical compound with the molecular formula C11H21NO4Si and a molecular weight of 259.37 g/mol. IUPAC name: 3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-azasilolidine-5-carboxylic acid. InChIKey: BUYPNQDTQVFCBL-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4Si |
|---|---|
| Molecular weight | 259.37 g/mol |
| IUPAC name | 3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-azasilolidine-5-carboxylic acid |
| InChIKey | BUYPNQDTQVFCBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[Si](CC1C(=O)O)(C)C |
Computed by PubChem (NCBI)