CAS 1822633-59-9 appears in our catalog under these names: 3-(Methyl(methylimino)oxo-lambda6-sulfanyl)aniline, 98%, 3-(Methyl(methylimino)oxo-λ6-sulfanyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g, 50mg.
3-(N,S-dimethylsulfonimidoyl)aniline (CAS 1822633-59-9) is a chemical compound with the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. IUPAC name: 3-(N,S-dimethylsulfonimidoyl)aniline. InChIKey: XYYFPHNGTYRUHL-UHFFFAOYSA-N.
| Molecular formula | C8H12N2OS |
|---|---|
| Molecular weight | 184.26 g/mol |
| IUPAC name | 3-(N,S-dimethylsulfonimidoyl)aniline |
| InChIKey | XYYFPHNGTYRUHL-UHFFFAOYSA-N |
| SMILES | CN=S(=O)(C)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)