CAS 18228-16-5 appears in our catalog under these names: Naphthol as-cl phosphate, 95%, Naphthol AS-CL phosphate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 2g.
[3-[(5-chloro-2-methoxyphenyl)carbamoyl]naphthalen-2-yl] dihydrogen phosphate (CAS 18228-16-5) is a chemical compound with the molecular formula C18H15ClNO6P and a molecular weight of 407.7 g/mol. IUPAC name: [3-[(5-chloro-2-methoxyphenyl)carbamoyl]naphthalen-2-yl] dihydrogen phosphate. InChIKey: AXMIMEOLDUCZOC-UHFFFAOYSA-N.
| Molecular formula | C18H15ClNO6P |
|---|---|
| Molecular weight | 407.7 g/mol |
| IUPAC name | [3-[(5-chloro-2-methoxyphenyl)carbamoyl]naphthalen-2-yl] dihydrogen phosphate |
| InChIKey | AXMIMEOLDUCZOC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)NC(=O)C2=CC3=CC=CC=C3C=C2OP(=O)(O)O |
Computed by PubChem (NCBI)