Products 1822861-90-4

CAS 1822861-90-4 is the registry number for 4,4-Diethoxy-2-(hydroxymethyl)butyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[4,4-diethoxy-2-(hydroxymethyl)butyl] acetate (CAS 1822861-90-4) is a chemical compound with the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. IUPAC name: [4,4-diethoxy-2-(hydroxymethyl)butyl] acetate. InChIKey: UFSFOZXONNJSBH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22O5
Molecular weight234.29 g/mol
IUPAC name[4,4-diethoxy-2-(hydroxymethyl)butyl] acetate
InChIKeyUFSFOZXONNJSBH-UHFFFAOYSA-N
SMILESCCOC(CC(CO)COC(=O)C)OCC

Computed by PubChem (NCBI)