CAS 1823051-16-6 is the registry number for 2-Chloro-3-fluoro-4-sulfanylbenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-3-fluoro-4-sulfanylbenzoic acid (CAS 1823051-16-6) is a chemical compound with the molecular formula C7H4ClFO2S and a molecular weight of 206.62 g/mol. IUPAC name: 2-chloro-3-fluoro-4-sulfanylbenzoic acid. InChIKey: HXFVXPLRYAPVTH-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO2S |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 2-chloro-3-fluoro-4-sulfanylbenzoic acid |
| InChIKey | HXFVXPLRYAPVTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)F)S |
Computed by PubChem (NCBI)