Products 1823051-16-6

CAS 1823051-16-6 is the registry number for 2-Chloro-3-fluoro-4-sulfanylbenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-chloro-3-fluoro-4-sulfanylbenzoic acid (CAS 1823051-16-6) is a chemical compound with the molecular formula C7H4ClFO2S and a molecular weight of 206.62 g/mol. IUPAC name: 2-chloro-3-fluoro-4-sulfanylbenzoic acid. InChIKey: HXFVXPLRYAPVTH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClFO2S
Molecular weight206.62 g/mol
IUPAC name2-chloro-3-fluoro-4-sulfanylbenzoic acid
InChIKeyHXFVXPLRYAPVTH-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)Cl)F)S

Computed by PubChem (NCBI)