CAS 1823053-96-8 is the registry number for Sodium 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-sulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-sulfonate (CAS 1823053-96-8) is a chemical compound with the molecular formula C7H12NNaO3S and a molecular weight of 213.23 g/mol. IUPAC name: sodium 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-sulfonate. InChIKey: VHBJAACWNUGGKA-UHFFFAOYSA-M.
| Molecular formula | C7H12NNaO3S |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | sodium 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-sulfonate |
| InChIKey | VHBJAACWNUGGKA-UHFFFAOYSA-M |
| SMILES | CC1(C2C1C(NC2)S(=O)(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)