CAS 1823117-23-2 is the registry number for 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine (CAS 1823117-23-2) is a chemical compound with the molecular formula C11H20BNO2 and a molecular weight of 209.10 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine. InChIKey: OWRFJRVFHBJODM-UHFFFAOYSA-N.
| Molecular formula | C11H20BNO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine |
| InChIKey | OWRFJRVFHBJODM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCNC2 |
Computed by PubChem (NCBI)