CAS 1823246-09-8 is the registry number for 3-(Pentafluoroethyl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(1,1,2,2,2-pentafluoroethyl)benzonitrile (CAS 1823246-09-8) is a chemical compound with the molecular formula C9H4F5N and a molecular weight of 221.13 g/mol. IUPAC name: 3-(1,1,2,2,2-pentafluoroethyl)benzonitrile. InChIKey: SCGALEBRKOHKKZ-UHFFFAOYSA-N.
| Molecular formula | C9H4F5N |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 3-(1,1,2,2,2-pentafluoroethyl)benzonitrile |
| InChIKey | SCGALEBRKOHKKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(C(F)(F)F)(F)F)C#N |
Computed by PubChem (NCBI)