CAS 1823274-68-5 appears in our catalog under these names: 3,4-Methylenedioxy-N-benzylcathinone Hydrochloride, 3,4-Methylenedioxy-N-benzylcathinone Hydrochloride 1.0 mg/ml in Methanol (as free base). Offered by: TRC, LoGiCal, Biosynth. Available pack sizes: 100mg, 10mg, 1ml, 5mg.
1-(1,3-benzodioxol-5-yl)-2-(benzylamino)propan-1-one;hydrochloride (CAS 1823274-68-5) is a chemical compound with the molecular formula C17H18ClNO3 and a molecular weight of 319.8 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(benzylamino)propan-1-one;hydrochloride. InChIKey: VPHHNGQFGIQHOU-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO3 |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(benzylamino)propan-1-one;hydrochloride |
| InChIKey | VPHHNGQFGIQHOU-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC2=C(C=C1)OCO2)NCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)