Products 1823321-19-2
CAS 1823321-19-2 is the registry number for 2,2,2-Trifluoro-1-(2,3,5-trichlorophenyl)ethanone. Offered by: Biosynth. Available pack sizes: 10g, 5g.
2,2,2-trifluoro-1-(2,3,5-trichlorophenyl)ethanone (CAS 1823321-19-2) is a chemical compound with the molecular formula C8H2Cl3F3O and a molecular weight of 277.4 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2,3,5-trichlorophenyl)ethanone. InChIKey: IJTKIQWLULOOAH-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl3F3O |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2,3,5-trichlorophenyl)ethanone |
| InChIKey | IJTKIQWLULOOAH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)C(F)(F)F)Cl)Cl)Cl |
Computed by PubChem (NCBI)