Products 1823394-16-6
CAS 1823394-16-6 is the registry number for tert-Butyl 3-(2,4-dimethylphenyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(2,4-dimethylphenyl)pyrrolidine-1-carboxylate (CAS 1823394-16-6) is a chemical compound with the molecular formula C17H25NO2 and a molecular weight of 275.4 g/mol. IUPAC name: tert-butyl 3-(2,4-dimethylphenyl)pyrrolidine-1-carboxylate. InChIKey: NCIQWPRVBORXJH-UHFFFAOYSA-N.
| Molecular formula | C17H25NO2 |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | tert-butyl 3-(2,4-dimethylphenyl)pyrrolidine-1-carboxylate |
| InChIKey | NCIQWPRVBORXJH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2CCN(C2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)