CAS 1823431-32-8 appears in our catalog under these names: 4,6-Dichloro-2-(propylsulfinyl)pyrimidin-5-amine, 98%, 4,6–Dichloro–2–(propylsulfinyl)pyrimidin–5–amine. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg.
4,6-dichloro-2-propylsulfinylpyrimidin-5-amine (CAS 1823431-32-8) is a chemical compound with the molecular formula C7H9Cl2N3OS and a molecular weight of 254.14 g/mol. IUPAC name: 4,6-dichloro-2-propylsulfinylpyrimidin-5-amine. InChIKey: KDEUGJKURKSXBF-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3OS |
|---|---|
| Molecular weight | 254.14 g/mol |
| IUPAC name | 4,6-dichloro-2-propylsulfinylpyrimidin-5-amine |
| InChIKey | KDEUGJKURKSXBF-UHFFFAOYSA-N |
| SMILES | CCCS(=O)C1=NC(=C(C(=N1)Cl)N)Cl |
Computed by PubChem (NCBI)