Products 1823547-05-2

CAS 1823547-05-2 is the registry number for [5-Amino-3-(trifluoromethyl)-1h-pyrazol-1-yl]acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

2-[5-amino-3-(trifluoromethyl)pyrazol-1-yl]acetic acid;hydrochloride (CAS 1823547-05-2) is a chemical compound with the molecular formula C6H7ClF3N3O2 and a molecular weight of 245.59 g/mol. IUPAC name: 2-[5-amino-3-(trifluoromethyl)pyrazol-1-yl]acetic acid;hydrochloride. InChIKey: IAGWZXRCLUQMJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClF3N3O2
Molecular weight245.59 g/mol
IUPAC name2-[5-amino-3-(trifluoromethyl)pyrazol-1-yl]acetic acid;hydrochloride
InChIKeyIAGWZXRCLUQMJJ-UHFFFAOYSA-N
SMILESC1=C(N(N=C1C(F)(F)F)CC(=O)O)N.Cl

Computed by PubChem (NCBI)