CAS 1823565-96-3 appears in our catalog under these names: Methyl 2–Fluoro–3–iodo–6–(methylsulfonyl)benzoate, Methyl 2-fluoro-3-iodo-6-(methylsulfonyl)benzoate, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-fluoro-3-iodo-6-methylsulfonylbenzoate (CAS 1823565-96-3) is a chemical compound with the molecular formula C9H8FIO4S and a molecular weight of 358.13 g/mol. IUPAC name: methyl 2-fluoro-3-iodo-6-methylsulfonylbenzoate. InChIKey: JHKYYBVJHYNQAO-UHFFFAOYSA-N.
| Molecular formula | C9H8FIO4S |
|---|---|
| Molecular weight | 358.13 g/mol |
| IUPAC name | methyl 2-fluoro-3-iodo-6-methylsulfonylbenzoate |
| InChIKey | JHKYYBVJHYNQAO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)I)S(=O)(=O)C |
Computed by PubChem (NCBI)