Products 1823585-31-4
CAS 1823585-31-4 is the registry number for Tert-butyl 6-bromo-5-methyl-3,4-dihydroisoquinoline-2(1H)-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 6-bromo-5-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 1823585-31-4) is a chemical compound with the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. IUPAC name: tert-butyl 6-bromo-5-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: KYARFYNZFOIUHM-UHFFFAOYSA-N.
| Molecular formula | C15H20BrNO2 |
|---|---|
| Molecular weight | 326.23 g/mol |
| IUPAC name | tert-butyl 6-bromo-5-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | KYARFYNZFOIUHM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1CCN(C2)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)