CAS 182369-73-9 appears in our catalog under these names: Voriconazole EP Impurity B, rel-(2R,3S)-2-(2,4-Difluorophenyl)-3-(pyrimidin-4-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol, 95+%, Fluconazole Impurity 20,Voriconazole EP Impurity B, Voriconazole Impurity 18(Voriconazole EP Impurity B), rac 5-Desfluoro Voriconazole, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(2R,3S)-2-(2,4-difluorophenyl)-3-pyrimidin-4-yl-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 182369-73-9) is a chemical compound with the molecular formula C16H15F2N5O and a molecular weight of 331.32 g/mol. IUPAC name: (2R,3S)-2-(2,4-difluorophenyl)-3-pyrimidin-4-yl-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: ZVQLILUCRUIFNH-MEDUHNTESA-N.
| Molecular formula | C16H15F2N5O |
|---|---|
| Molecular weight | 331.32 g/mol |
| IUPAC name | (2R,3S)-2-(2,4-difluorophenyl)-3-pyrimidin-4-yl-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | ZVQLILUCRUIFNH-MEDUHNTESA-N |
| SMILES | C[C@@H](C1=NC=NC=C1)[C@](CN2C=NC=N2)(C3=C(C=C(C=C3)F)F)O |
Computed by PubChem (NCBI)