Products 1823793-09-4
CAS 1823793-09-4 is the registry number for tert-Butyl 3-chloro-7,8-dihydropyrido[3,4-b]pyrazine-6(5H)-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl 3-chloro-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-6-carboxylate (CAS 1823793-09-4) is a chemical compound with the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. IUPAC name: tert-butyl 3-chloro-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-6-carboxylate. InChIKey: JWCHUWJITAESLQ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O2 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | tert-butyl 3-chloro-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-6-carboxylate |
| InChIKey | JWCHUWJITAESLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=NC=C(N=C2C1)Cl |
Computed by PubChem (NCBI)