Products 1823835-61-5

CAS 1823835-61-5 is the registry number for Benzyl (5-fluoroazepan-4-yl)carbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-(5-fluoroazepan-4-yl)carbamate;hydrochloride (CAS 1823835-61-5) is a chemical compound with the molecular formula C14H20ClFN2O2 and a molecular weight of 302.77 g/mol. IUPAC name: benzyl N-(5-fluoroazepan-4-yl)carbamate;hydrochloride. InChIKey: LVJYQWXXIOGOIH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20ClFN2O2
Molecular weight302.77 g/mol
IUPAC namebenzyl N-(5-fluoroazepan-4-yl)carbamate;hydrochloride
InChIKeyLVJYQWXXIOGOIH-UHFFFAOYSA-N
SMILESC1CNCCC(C1NC(=O)OCC2=CC=CC=C2)F.Cl

Computed by PubChem (NCBI)