Products 1823888-15-8

CAS 1823888-15-8 is the registry number for tert-Butyl N-(2-bromo-5-methyl-1,3-thiazol-4-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 250mg, 100mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-bromo-5-methyl-1,3-thiazol-4-yl)carbamate (CAS 1823888-15-8) is a chemical compound with the molecular formula C9H13BrN2O2S and a molecular weight of 293.18 g/mol. IUPAC name: tert-butyl N-(2-bromo-5-methyl-1,3-thiazol-4-yl)carbamate. InChIKey: XPPWJRKUJSYDPK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BrN2O2S
Molecular weight293.18 g/mol
IUPAC nametert-butyl N-(2-bromo-5-methyl-1,3-thiazol-4-yl)carbamate
InChIKeyXPPWJRKUJSYDPK-UHFFFAOYSA-N
SMILESCC1=C(N=C(S1)Br)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)