CAS 1823888-15-8 is the registry number for tert-Butyl N-(2-bromo-5-methyl-1,3-thiazol-4-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 250mg, 100mg, 500mg, 1000mg.
Tert-butyl N-(2-bromo-5-methyl-1,3-thiazol-4-yl)carbamate (CAS 1823888-15-8) is a chemical compound with the molecular formula C9H13BrN2O2S and a molecular weight of 293.18 g/mol. IUPAC name: tert-butyl N-(2-bromo-5-methyl-1,3-thiazol-4-yl)carbamate. InChIKey: XPPWJRKUJSYDPK-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN2O2S |
|---|---|
| Molecular weight | 293.18 g/mol |
| IUPAC name | tert-butyl N-(2-bromo-5-methyl-1,3-thiazol-4-yl)carbamate |
| InChIKey | XPPWJRKUJSYDPK-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)