CAS 1823893-90-8 is the registry number for 5-(4-Fluoro-3-iodophenyl)-1,3-oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(4-fluoro-3-iodophenyl)-1,3-oxazole (CAS 1823893-90-8) is a chemical compound with the molecular formula C9H5FINO and a molecular weight of 289.04 g/mol. IUPAC name: 5-(4-fluoro-3-iodophenyl)-1,3-oxazole. InChIKey: DNBVWYIPEHATNP-UHFFFAOYSA-N.
| Molecular formula | C9H5FINO |
|---|---|
| Molecular weight | 289.04 g/mol |
| IUPAC name | 5-(4-fluoro-3-iodophenyl)-1,3-oxazole |
| InChIKey | DNBVWYIPEHATNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CN=CO2)I)F |
Computed by PubChem (NCBI)