Products 1823902-61-9
CAS 1823902-61-9 is the registry number for 3-Chloro-6-iodo-2-nitroaniline, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-6-iodo-2-nitroaniline (CAS 1823902-61-9) is a chemical compound with the molecular formula C6H4ClIN2O2 and a molecular weight of 298.46 g/mol. IUPAC name: 3-chloro-6-iodo-2-nitroaniline. InChIKey: YGRIQKULFORZRJ-UHFFFAOYSA-N.
| Molecular formula | C6H4ClIN2O2 |
|---|---|
| Molecular weight | 298.46 g/mol |
| IUPAC name | 3-chloro-6-iodo-2-nitroaniline |
| InChIKey | YGRIQKULFORZRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)[N+](=O)[O-])N)I |
Computed by PubChem (NCBI)