CAS 2091033-65-5 is the registry number for 4–chloro–5–iodo–2–nitroaniline. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
4-chloro-5-iodo-2-nitroaniline (CAS 2091033-65-5) is a chemical compound with the molecular formula C6H4ClIN2O2 and a molecular weight of 298.46 g/mol. IUPAC name: 4-chloro-5-iodo-2-nitroaniline. InChIKey: RQNHDVICHHABKH-UHFFFAOYSA-N.
| Molecular formula | C6H4ClIN2O2 |
|---|---|
| Molecular weight | 298.46 g/mol |
| IUPAC name | 4-chloro-5-iodo-2-nitroaniline |
| InChIKey | RQNHDVICHHABKH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)Cl)[N+](=O)[O-])N |
Computed by PubChem (NCBI)