CAS 1823931-68-5 appears in our catalog under these names: [3-(trifluoromethyl)bicyclo[1.1.1]pentan-1-yl]hydrazine dihydrochloride, 97%, 97%, (3-(TRIFLUOROMETHYL)BICYCLO[1.1.1]PENTAN-1-YL)HYDRAZINE DIHYDROCHLORIDE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
[3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]hydrazine;dihydrochloride (CAS 1823931-68-5) is a chemical compound with the molecular formula C6H11Cl2F3N2 and a molecular weight of 239.06 g/mol. IUPAC name: [3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]hydrazine;dihydrochloride. InChIKey: QGDRLAJXLXETDS-UHFFFAOYSA-N.
| Molecular formula | C6H11Cl2F3N2 |
|---|---|
| Molecular weight | 239.06 g/mol |
| IUPAC name | [3-(trifluoromethyl)-1-bicyclo[1.1.1]pentanyl]hydrazine;dihydrochloride |
| InChIKey | QGDRLAJXLXETDS-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)NN)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)