Products 1823935-84-7
CAS 1823935-84-7 is the registry number for 3-(Bicyclo(1.1.1)pentan-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 100mg, 500mg, 250mg.
3-(1-bicyclo[1.1.1]pentanyl)aniline (CAS 1823935-84-7) is a chemical compound with the molecular formula C11H13N and a molecular weight of 159.23 g/mol. IUPAC name: 3-(1-bicyclo[1.1.1]pentanyl)aniline. InChIKey: ZQPLUPVFDWPXJX-UHFFFAOYSA-N.
| Molecular formula | C11H13N |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | 3-(1-bicyclo[1.1.1]pentanyl)aniline |
| InChIKey | ZQPLUPVFDWPXJX-UHFFFAOYSA-N |
| SMILES | C1C2CC1(C2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)