CAS 1823962-17-9 is the registry number for 2,3,5-Trifluoro-4-hydrazinobenzohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,3,5-trifluoro-4-hydrazinylbenzohydrazide (CAS 1823962-17-9) is a chemical compound with the molecular formula C7H7F3N4O and a molecular weight of 220.15 g/mol. IUPAC name: 2,3,5-trifluoro-4-hydrazinylbenzohydrazide. InChIKey: NTLHMGKLKQZHGN-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N4O |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | 2,3,5-trifluoro-4-hydrazinylbenzohydrazide |
| InChIKey | NTLHMGKLKQZHGN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)NN)F)F)C(=O)NN |
Computed by PubChem (NCBI)