CAS 1823982-49-5 appears in our catalog under these names: Mesna Impurity 6, Mesna Impurity 3, Mesna Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(diaminomethylidenecarbamoylsulfanyl)ethanesulfonic acid (CAS 1823982-49-5) is a chemical compound with the molecular formula C4H9N3O4S2 and a molecular weight of 227.3 g/mol. IUPAC name: 2-(diaminomethylidenecarbamoylsulfanyl)ethanesulfonic acid. InChIKey: LUZSWZVYJVZDFY-UHFFFAOYSA-N.
| Molecular formula | C4H9N3O4S2 |
|---|---|
| Molecular weight | 227.3 g/mol |
| IUPAC name | 2-(diaminomethylidenecarbamoylsulfanyl)ethanesulfonic acid |
| InChIKey | LUZSWZVYJVZDFY-UHFFFAOYSA-N |
| SMILES | C(CS(=O)(=O)O)SC(=O)N=C(N)N |
Computed by PubChem (NCBI)